C24H22N6O4S — CID 16859112
12-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859112) has the molecular formula C24H22N6O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is 12-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 12-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859112 |
| Molecular Formula | C24H22N6O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 12-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C24H22N6O4S/c31-20(27-8-10-28(11-9-27)23(33)19-7-4-12-34-19)13-17-15-35-24-26-21-18(22(32)29(17)24)14-25-30(21)16-5-2-1-3-6-16/h1-7,12,14,17H,8-11,13,15H2 |
| InChIKey | ZYSFZXHTVLHJLP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 106.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |