C27H26ClN5O2S — CID 16859747
12-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(3-chlorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859747) has the molecular formula C27H26ClN5O2S and a molecular weight of 520.06 g/mol. Its IUPAC name is 12-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(3-chlorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 12-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(3-chlorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859747 |
| Molecular Formula | C27H26ClN5O2S |
| Molecular Weight | 520.06 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 12-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-6-(3-chlorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26ClN5O2S/c28-20-7-4-8-21(14-20)33-25-23(16-29-33)26(35)32-22(17-36-27(32)30-25)15-24(34)31-11-9-19(10-12-31)13-18-5-2-1-3-6-18/h1-8,14,16,19,22H,9-13,15,17H2 |
| InChIKey | KEYLGKRPWSCQPL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.06 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |