C27H21ClN6O2S — CID 16859942
N-(4-anilinophenyl)-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16859942) has the molecular formula C27H21ClN6O2S and a molecular weight of 529.03 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(4-anilinophenyl)-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16859942 |
| Molecular Formula | C27H21ClN6O2S |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-(4-anilinophenyl)-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H21ClN6O2S/c28-17-5-4-8-21(13-17)34-25-23(15-29-34)26(36)33-22(16-37-27(33)32-25)14-24(35)31-20-11-9-19(10-12-20)30-18-6-2-1-3-7-18/h1-13,15,22,30H,14,16H2,(H,31,35) |
| InChIKey | ALUKEVGTNCQZLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |