C22H17ClN6O3S — CID 16860164
4-[[2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzamide (PubChem CID 16860164) has the molecular formula C22H17ClN6O3S and a molecular weight of 480.94 g/mol. Its IUPAC name is 4-[[2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16860164 |
| Molecular Formula | C22H17ClN6O3S |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4-[[2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CC2CSc3nc4c(cnn4-c4ccc(Cl)cc4)c(=O)n32)cc1 |
| InChI | InChI=1S/C22H17ClN6O3S/c23-13-3-7-15(8-4-13)29-20-17(10-25-29)21(32)28-16(11-33-22(28)27-20)9-18(30)26-14-5-1-12(2-6-14)19(24)31/h1-8,10,16H,9,11H2,(H2,24,31)(H,26,30) |
| InChIKey | RSAGGKUVBLAZPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |