C21H13F4N5O2S — CID 16860376
2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 16860376) has the molecular formula C21H13F4N5O2S and a molecular weight of 475.43 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 16860376 |
| Molecular Formula | C21H13F4N5O2S |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H13F4N5O2S/c22-10-1-3-11(4-2-10)30-19-13(8-26-30)20(32)29-12(9-33-21(29)28-19)7-16(31)27-15-6-5-14(23)17(24)18(15)25/h1-6,8,12H,7,9H2,(H,27,31) |
| InChIKey | GYHYBVUGNLQHLZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|