C21H17FN6O2S — CID 42477075
2-[(12R)-6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 42477075) has the molecular formula C21H17FN6O2S and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[(12R)-6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[(12R)-6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42477075 |
| Molecular Formula | C21H17FN6O2S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[(12R)-6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21)NCc1ccccn1 |
| InChI | InChI=1S/C21H17FN6O2S/c22-13-4-6-15(7-5-13)28-19-17(11-25-28)20(30)27-16(12-31-21(27)26-19)9-18(29)24-10-14-3-1-2-8-23-14/h1-8,11,16H,9-10,12H2,(H,24,29)/t16-/m1/s1 |
| InChIKey | YPKQZWYTLDVNJM-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |