C22H25FN6O3S — CID 16860237
2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 16860237) has the molecular formula C22H25FN6O3S and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 16860237 |
| Molecular Formula | C22H25FN6O3S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21)NCCCN1CCOCC1 |
| InChI | InChI=1S/C22H25FN6O3S/c23-15-2-4-16(5-3-15)29-20-18(13-25-29)21(31)28-17(14-33-22(28)26-20)12-19(30)24-6-1-7-27-8-10-32-11-9-27/h2-5,13,17H,1,6-12,14H2,(H,24,30) |
| InChIKey | KBEOOXUTZKPOJS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|