C22H24N6O3S — CID 16859157
2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 16859157) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 16859157 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21)NCCCN1CCCC1=O |
| InChI | InChI=1S/C22H24N6O3S/c29-18(23-9-5-11-26-10-4-8-19(26)30)12-16-14-32-22-25-20-17(21(31)27(16)22)13-24-28(20)15-6-2-1-3-7-15/h1-3,6-7,13,16H,4-5,8-12,14H2,(H,23,29) |
| InChIKey | RFUVMMQOOLYMTE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|