C22H26N6O3S — CID 16859565
2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 16859565) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is 2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 16859565 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | Cc1cccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N6O3S/c1-15-3-2-4-16(11-15)28-20-18(13-24-28)21(30)27-17(14-32-22(27)25-20)12-19(29)23-5-6-26-7-9-31-10-8-26/h2-4,11,13,17H,5-10,12,14H2,1H3,(H,23,29) |
| InChIKey | AQOWAZFNPRSKRX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |