C20H23N5O3S — CID 16860449
2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 16860449) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 16860449 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CC1CSc2nc3c(cnn3-c3ccc(C)c(C)c3)c(=O)n21 |
| InChI | InChI=1S/C20H23N5O3S/c1-12-4-5-14(8-13(12)2)25-18-16(10-22-25)19(27)24-15(11-29-20(24)23-18)9-17(26)21-6-7-28-3/h4-5,8,10,15H,6-7,9,11H2,1-3H3,(H,21,26) |
| InChIKey | VTRTUIWNLASZMI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|