C21H23N5O4S — CID 16860454
ethyl 2-[[2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]acetate (PubChem CID 16860454) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is ethyl 2-[[2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 16860454 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | ethyl 2-[[2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CC1CSc2nc3c(cnn3-c3ccc(C)c(C)c3)c(=O)n21 |
| InChI | InChI=1S/C21H23N5O4S/c1-4-30-18(28)10-22-17(27)8-15-11-31-21-24-19-16(20(29)25(15)21)9-23-26(19)14-6-5-12(2)13(3)7-14/h5-7,9,15H,4,8,10-11H2,1-3H3,(H,22,27) |
| InChIKey | HGMACEAKVNJENF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |