C27H29N5O4S — CID 16860489
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860489) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860489 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CC2CSc3nc4c(cnn4-c4ccc(C)c(C)c4)c(=O)n32)cc1OC |
| InChI | InChI=1S/C27H29N5O4S/c1-16-5-7-19(11-17(16)2)32-25-21(14-29-32)26(34)31-20(15-37-27(31)30-25)13-24(33)28-10-9-18-6-8-22(35-3)23(12-18)36-4/h5-8,11-12,14,20H,9-10,13,15H2,1-4H3,(H,28,33) |
| InChIKey | PZYHNVBZRONIEC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |