C24H22ClN5O3S — CID 16860151
2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 16860151) has the molecular formula C24H22ClN5O3S and a molecular weight of 495.99 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 16860151 |
| Molecular Formula | C24H22ClN5O3S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc(CCNC(=O)CC2CSc3nc4c(cnn4-c4ccc(Cl)cc4)c(=O)n32)c1 |
| InChI | InChI=1S/C24H22ClN5O3S/c1-33-19-4-2-3-15(11-19)9-10-26-21(31)12-18-14-34-24-28-22-20(23(32)29(18)24)13-27-30(22)17-7-5-16(25)6-8-17/h2-8,11,13,18H,9-10,12,14H2,1H3,(H,26,31) |
| InChIKey | NKTOHERYKXRBNV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |