C23H20ClN5O2S — CID 16860112
2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 16860112) has the molecular formula C23H20ClN5O2S and a molecular weight of 465.97 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 16860112 |
| Molecular Formula | C23H20ClN5O2S |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CC1CSc2nc3c(cnn3-c3ccc(Cl)cc3)c(=O)n21 |
| InChI | InChI=1S/C23H20ClN5O2S/c1-13-4-3-5-14(2)20(13)26-19(30)10-17-12-32-23-27-21-18(22(31)28(17)23)11-25-29(21)16-8-6-15(24)7-9-16/h3-9,11,17H,10,12H2,1-2H3,(H,26,30) |
| InChIKey | QLLMHLAGMMARFE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |