C21H15ClN6O4S — CID 16860073
2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 16860073) has the molecular formula C21H15ClN6O4S and a molecular weight of 482.91 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16860073 |
| Molecular Formula | C21H15ClN6O4S |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccc(Cl)cc3)c(=O)n21)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15ClN6O4S/c22-12-5-7-13(8-6-12)27-19-15(10-23-27)20(30)26-14(11-33-21(26)25-19)9-18(29)24-16-3-1-2-4-17(16)28(31)32/h1-8,10,14H,9,11H2,(H,24,29) |
| InChIKey | LCUVKBCDKUADBA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|