C22H18N6O4S — CID 16859399
2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide (PubChem CID 16859399) has the molecular formula C22H18N6O4S and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16859399 |
| Molecular Formula | C22H18N6O4S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-nitrophenyl)acetamide |
| SMILES | Cc1ccccc1-n1ncc2c(=O)n3c(nc21)SCC3CC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N6O4S/c1-13-6-2-4-8-17(13)27-20-15(11-23-27)21(30)26-14(12-33-22(26)25-20)10-19(29)24-16-7-3-5-9-18(16)28(31)32/h2-9,11,14H,10,12H2,1H3,(H,24,29) |
| InChIKey | OWAUICYZFZJQMP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|