C25H23N5O4S — CID 16859418
ethyl 4-[[2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate (PubChem CID 16859418) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is ethyl 4-[[2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16859418 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | ethyl 4-[[2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2CSc3nc4c(cnn4-c4ccccc4C)c(=O)n32)cc1 |
| InChI | InChI=1S/C25H23N5O4S/c1-3-34-24(33)16-8-10-17(11-9-16)27-21(31)12-18-14-35-25-28-22-19(23(32)29(18)25)13-26-30(22)20-7-5-4-6-15(20)2/h4-11,13,18H,3,12,14H2,1-2H3,(H,27,31) |
| InChIKey | OWAVZJLJSVDPKK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |