C25H25N5O2S — CID 16860786
N-(3,4-dimethylphenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860786) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860786 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)Nc2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C25H25N5O2S/c1-14-5-8-21(17(4)9-14)30-23-20(12-26-30)24(32)29-19(13-33-25(29)28-23)11-22(31)27-18-7-6-15(2)16(3)10-18/h5-10,12,19H,11,13H2,1-4H3,(H,27,31) |
| InChIKey | YBFCYNBIVNQHQX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |