C23H22N6O2S — CID 16860709
2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 16860709) has the molecular formula C23H22N6O2S and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 16860709 |
| Molecular Formula | C23H22N6O2S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)NCc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C23H22N6O2S/c1-14-5-6-19(15(2)8-14)29-21-18(12-26-29)22(31)28-17(13-32-23(28)27-21)9-20(30)25-11-16-4-3-7-24-10-16/h3-8,10,12,17H,9,11,13H2,1-2H3,(H,25,30) |
| InChIKey | KEUJGUMXPRAVRK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |