C24H21N5O4S — CID 16859356
N-(1,3-benzodioxol-5-ylmethyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16859356) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16859356 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccccc1-n1ncc2c(=O)n3c(nc21)SCC3CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N5O4S/c1-14-4-2-3-5-18(14)29-22-17(11-26-29)23(31)28-16(12-34-24(28)27-22)9-21(30)25-10-15-6-7-19-20(8-15)33-13-32-19/h2-8,11,16H,9-10,12-13H2,1H3,(H,25,30) |
| InChIKey | WDASTSJDKCMDHP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |