C22H25N5O2S — CID 16859290
6-(2-methylphenyl)-12-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859290) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 6-(2-methylphenyl)-12-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(2-methylphenyl)-12-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859290 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 6-(2-methylphenyl)-12-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | Cc1ccccc1-n1ncc2c(=O)n3c(nc21)SCC3CC(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H25N5O2S/c1-14-7-9-25(10-8-14)19(28)11-16-13-30-22-24-20-17(21(29)26(16)22)12-23-27(20)18-6-4-3-5-15(18)2/h3-6,12,14,16H,7-11,13H2,1-2H3 |
| InChIKey | TVQVEQKAEVEOAN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |