C21H24N6O2S — CID 30607864
(12S)-6-(3-methylphenyl)-12-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 30607864) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is (12S)-6-(3-methylphenyl)-12-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | (12S)-6-(3-methylphenyl)-12-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 30607864 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (12S)-6-(3-methylphenyl)-12-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | Cc1cccc(-n2ncc3c(=O)n4c(nc32)SC[C@@H]4CC(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H24N6O2S/c1-14-4-3-5-15(10-14)27-19-17(12-22-27)20(29)26-16(13-30-21(26)23-19)11-18(28)25-8-6-24(2)7-9-25/h3-5,10,12,16H,6-9,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | UWHPSABTKYGHSQ-INIZCTEOSA-N |
| XLogP | 1.70 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |