C23H18N6O2S — CID 16859639
N-(2-cyanophenyl)-2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16859639) has the molecular formula C23H18N6O2S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16859639 |
| Molecular Formula | C23H18N6O2S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-(2-cyanophenyl)-2-[6-(3-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1cccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C23H18N6O2S/c1-14-5-4-7-16(9-14)29-21-18(12-25-29)22(31)28-17(13-32-23(28)27-21)10-20(30)26-19-8-3-2-6-15(19)11-24/h2-9,12,17H,10,13H2,1H3,(H,26,30) |
| InChIKey | WLKPQKPDMZKNAC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |