C24H19N7O4S — CID 16860764
N-(2-cyano-4-nitrophenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860764) has the molecular formula C24H19N7O4S and a molecular weight of 501.53 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860764 |
| Molecular Formula | C24H19N7O4S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)Nc2ccc([N+](=O)[O-])cc2C#N)c(C)c1 |
| InChI | InChI=1S/C24H19N7O4S/c1-13-3-6-20(14(2)7-13)30-22-18(11-26-30)23(33)29-17(12-36-24(29)28-22)9-21(32)27-19-5-4-16(31(34)35)8-15(19)10-25/h3-8,11,17H,9,12H2,1-2H3,(H,27,32) |
| InChIKey | RYZKCHMXRPUUOF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|