C22H17FN6O4S — CID 16860348
2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 16860348) has the molecular formula C22H17FN6O4S and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16860348 |
| Molecular Formula | C22H17FN6O4S |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21 |
| InChI | InChI=1S/C22H17FN6O4S/c1-12-8-15(29(32)33)6-7-18(12)25-19(30)9-16-11-34-22-26-20-17(21(31)27(16)22)10-24-28(20)14-4-2-13(23)3-5-14/h2-8,10,16H,9,11H2,1H3,(H,25,30) |
| InChIKey | DCZTUZLSLYOFHG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|