C23H18FN5O4S — CID 16860316
methyl 4-[[2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate (PubChem CID 16860316) has the molecular formula C23H18FN5O4S and a molecular weight of 479.49 g/mol. Its IUPAC name is methyl 4-[[2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16860316 |
| Molecular Formula | C23H18FN5O4S |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | methyl 4-[[2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2CSc3nc4c(cnn4-c4ccc(F)cc4)c(=O)n32)cc1 |
| InChI | InChI=1S/C23H18FN5O4S/c1-33-22(32)13-2-6-15(7-3-13)26-19(30)10-17-12-34-23-27-20-18(21(31)28(17)23)11-25-29(20)16-8-4-14(24)5-9-16/h2-9,11,17H,10,12H2,1H3,(H,26,30) |
| InChIKey | INGSUGRHYBEAGA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |