C21H23N5O4S — CID 16858990
methyl 4-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate (PubChem CID 16858990) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 4-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16858990 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl 4-[[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2CSc3nc4c(cnn4C(C)(C)C)c(=O)n32)cc1 |
| InChI | InChI=1S/C21H23N5O4S/c1-21(2,3)26-17-15(10-22-26)18(28)25-14(11-31-20(25)24-17)9-16(27)23-13-7-5-12(6-8-13)19(29)30-4/h5-8,10,14H,9,11H2,1-4H3,(H,23,27) |
| InChIKey | MPGKOVRCQHHMGM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |