C21H33N5O2S — CID 16859055
2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-octylacetamide (PubChem CID 16859055) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-octylacetamide.
| Compound Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-octylacetamide |
|---|---|
| PubChem CID | 16859055 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CC1CSc2nc3c(cnn3C(C)(C)C)c(=O)n21 |
| InChI | InChI=1S/C21H33N5O2S/c1-5-6-7-8-9-10-11-22-17(27)12-15-14-29-20-24-18-16(19(28)25(15)20)13-23-26(18)21(2,3)4/h13,15H,5-12,14H2,1-4H3,(H,22,27) |
| InChIKey | CPYFCCSZKCHDMB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|