C25H24FN5O2S — CID 16860275
N-butyl-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-phenylacetamide (PubChem CID 16860275) has the molecular formula C25H24FN5O2S and a molecular weight of 477.57 g/mol. Its IUPAC name is N-butyl-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-phenylacetamide.
| Compound Name | N-butyl-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16860275 |
| Molecular Formula | C25H24FN5O2S |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-butyl-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-phenylacetamide |
| SMILES | CCCCN(C(=O)CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21)c1ccccc1 |
| InChI | InChI=1S/C25H24FN5O2S/c1-2-3-13-29(18-7-5-4-6-8-18)22(32)14-20-16-34-25-28-23-21(24(33)30(20)25)15-27-31(23)19-11-9-17(26)10-12-19/h4-12,15,20H,2-3,13-14,16H2,1H3 |
| InChIKey | SAPCXZTUEHGTDJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |