C24H31FN6O2S — CID 16860235
N-[5-(diethylamino)pentan-2-yl]-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860235) has the molecular formula C24H31FN6O2S and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860235 |
| Molecular Formula | C24H31FN6O2S |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21 |
| InChI | InChI=1S/C24H31FN6O2S/c1-4-29(5-2)12-6-7-16(3)27-21(32)13-19-15-34-24-28-22-20(23(33)30(19)24)14-26-31(22)18-10-8-17(25)9-11-18/h8-11,14,16,19H,4-7,12-13,15H2,1-3H3,(H,27,32) |
| InChIKey | GHMBDUGVRKDRMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |