C19H20FN5O3S — CID 16860226
2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 16860226) has the molecular formula C19H20FN5O3S and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 16860226 |
| Molecular Formula | C19H20FN5O3S |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21 |
| InChI | InChI=1S/C19H20FN5O3S/c1-11(9-28-2)22-16(26)7-14-10-29-19-23-17-15(18(27)24(14)19)8-21-25(17)13-5-3-12(20)4-6-13/h3-6,8,11,14H,7,9-10H2,1-2H3,(H,22,26) |
| InChIKey | HTTUAXHBQZDHIU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |