C19H21N5O2S — CID 16860894
2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-propylacetamide (PubChem CID 16860894) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-propylacetamide.
| Compound Name | 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 16860894 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CC1CSc2nc3c(cnn3-c3ccc(C)cc3)c(=O)n21 |
| InChI | InChI=1S/C19H21N5O2S/c1-3-8-20-16(25)9-14-11-27-19-22-17-15(18(26)23(14)19)10-21-24(17)13-6-4-12(2)5-7-13/h4-7,10,14H,3,8-9,11H2,1-2H3,(H,20,25) |
| InChIKey | HMRVWUBCXXDIEL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |