C19H17N7O2S2 — CID 16861052
2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 16861052) has the molecular formula C19H17N7O2S2 and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16861052 |
| Molecular Formula | C19H17N7O2S2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)Nc2nnc(C)s2)cc1 |
| InChI | InChI=1S/C19H17N7O2S2/c1-10-3-5-12(6-4-10)26-16-14(8-20-26)17(28)25-13(9-29-19(25)22-16)7-15(27)21-18-24-23-11(2)30-18/h3-6,8,13H,7,9H2,1-2H3,(H,21,24,27) |
| InChIKey | CRTXLERNGFJWTC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |