C19H18N6O2S2 — CID 16861047
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16861047) has the molecular formula C19H18N6O2S2 and a molecular weight of 426.53 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16861047 |
| Molecular Formula | C19H18N6O2S2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-[6-(4-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C19H18N6O2S2/c1-11-2-4-12(5-3-11)25-16-14(9-21-25)17(27)24-13(10-29-19(24)23-16)8-15(26)22-18-20-6-7-28-18/h2-5,9,13H,6-8,10H2,1H3,(H,20,22,26) |
| InChIKey | SWIISDDQCZGMAM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |