C23H28ClN5O2S — CID 16860155
2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-octylacetamide (PubChem CID 16860155) has the molecular formula C23H28ClN5O2S and a molecular weight of 474.03 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-octylacetamide.
| Compound Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-octylacetamide |
|---|---|
| PubChem CID | 16860155 |
| Molecular Formula | C23H28ClN5O2S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CC1CSc2nc3c(cnn3-c3ccc(Cl)cc3)c(=O)n21 |
| InChI | InChI=1S/C23H28ClN5O2S/c1-2-3-4-5-6-7-12-25-20(30)13-18-15-32-23-27-21-19(22(31)28(18)23)14-26-29(21)17-10-8-16(24)9-11-17/h8-11,14,18H,2-7,12-13,15H2,1H3,(H,25,30) |
| InChIKey | DAYWSXRFNFBOJO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|