C26H36N6O2S — CID 16860687
N-[5-(diethylamino)pentan-2-yl]-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860687) has the molecular formula C26H36N6O2S and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860687 |
| Molecular Formula | C26H36N6O2S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-2-[6-(2,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CC1CSc2nc3c(cnn3-c3ccc(C)cc3C)c(=O)n21 |
| InChI | InChI=1S/C26H36N6O2S/c1-6-30(7-2)12-8-9-19(5)28-23(33)14-20-16-35-26-29-24-21(25(34)31(20)26)15-27-32(24)22-11-10-17(3)13-18(22)4/h10-11,13,15,19-20H,6-9,12,14,16H2,1-5H3,(H,28,33) |
| InChIKey | LBOZPLXKRVTLPA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |