C26H26ClN5O2S — CID 16859734
N-benzyl-N-butyl-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16859734) has the molecular formula C26H26ClN5O2S and a molecular weight of 508.05 g/mol. Its IUPAC name is N-benzyl-N-butyl-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-benzyl-N-butyl-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16859734 |
| Molecular Formula | C26H26ClN5O2S |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-benzyl-N-butyl-2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21 |
| InChI | InChI=1S/C26H26ClN5O2S/c1-2-3-12-30(16-18-8-5-4-6-9-18)23(33)14-21-17-35-26-29-24-22(25(34)31(21)26)15-28-32(24)20-11-7-10-19(27)13-20/h4-11,13,15,21H,2-3,12,14,16-17H2,1H3 |
| InChIKey | IGHPBRYLMWMAPH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |