C26H25FN6O2S — CID 16860202
12-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-6-(4-fluorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16860202) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is 12-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-6-(4-fluorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 12-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-6-(4-fluorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16860202 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 12-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-6-(4-fluorophenyl)-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccc(F)cc3)c(=O)n21)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H25FN6O2S/c27-19-6-8-20(9-7-19)33-24-22(15-28-33)25(35)32-21(17-36-26(32)29-24)14-23(34)31-12-10-30(11-13-31)16-18-4-2-1-3-5-18/h1-9,15,21H,10-14,16-17H2 |
| InChIKey | OZUVOOLIUDHAEU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |