C17H22N6O2S — CID 16858887
2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-(2-cyanoethyl)-N-methylacetamide (PubChem CID 16858887) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-(2-cyanoethyl)-N-methylacetamide.
| Compound Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-(2-cyanoethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 16858887 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-(2-cyanoethyl)-N-methylacetamide |
| SMILES | CN(CCC#N)C(=O)CC1CSc2nc3c(cnn3C(C)(C)C)c(=O)n21 |
| InChI | InChI=1S/C17H22N6O2S/c1-17(2,3)23-14-12(9-19-23)15(25)22-11(10-26-16(22)20-14)8-13(24)21(4)7-5-6-18/h9,11H,5,7-8,10H2,1-4H3 |
| InChIKey | BEDSXWKUIVTRBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |