C21H29N5O4S — CID 16858862
ethyl 1-[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate (PubChem CID 16858862) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is ethyl 1-[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 16858862 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | ethyl 1-[2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CC2CSc3nc4c(cnn4C(C)(C)C)c(=O)n32)C1 |
| InChI | InChI=1S/C21H29N5O4S/c1-5-30-19(29)13-7-6-8-24(11-13)16(27)9-14-12-31-20-23-17-15(18(28)25(14)20)10-22-26(17)21(2,3)4/h10,13-14H,5-9,11-12H2,1-4H3 |
| InChIKey | KOAUBVXKBAWWTG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |