C19H30N6O2S — CID 16858906
2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[2-(diethylamino)ethyl]acetamide (PubChem CID 16858906) has the molecular formula C19H30N6O2S and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[2-(diethylamino)ethyl]acetamide.
| Compound Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[2-(diethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 16858906 |
| Molecular Formula | C19H30N6O2S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-(6-tert-butyl-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)-N-[2-(diethylamino)ethyl]acetamide |
| SMILES | CCN(CC)CCNC(=O)CC1CSc2nc3c(cnn3C(C)(C)C)c(=O)n21 |
| InChI | InChI=1S/C19H30N6O2S/c1-6-23(7-2)9-8-20-15(26)10-13-12-28-18-22-16-14(17(27)24(13)18)11-21-25(16)19(3,4)5/h11,13H,6-10,12H2,1-5H3,(H,20,26) |
| InChIKey | SYVZPLLWFHCVRP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |