C20H29N5O2S — CID 16858867
6-tert-butyl-12-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16858867) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 6-tert-butyl-12-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-tert-butyl-12-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16858867 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-tert-butyl-12-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | CC1CC(C)CN(C(=O)CC2CSc3nc4c(cnn4C(C)(C)C)c(=O)n32)C1 |
| InChI | InChI=1S/C20H29N5O2S/c1-12-6-13(2)10-23(9-12)16(26)7-14-11-28-19-22-17-15(18(27)24(14)19)8-21-25(17)20(3,4)5/h8,12-14H,6-7,9-11H2,1-5H3 |
| InChIKey | IRFWOIIFOYEQDI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |