C23H25N5O4S — CID 16859094
ethyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate (PubChem CID 16859094) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 16859094 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | ethyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CC2CSc3nc4c(cnn4-c4ccccc4)c(=O)n32)C1 |
| InChI | InChI=1S/C23H25N5O4S/c1-2-32-22(31)15-7-6-10-26(13-15)19(29)11-17-14-33-23-25-20-18(21(30)27(17)23)12-24-28(20)16-8-4-3-5-9-16/h3-5,8-9,12,15,17H,2,6-7,10-11,13-14H2,1H3 |
| InChIKey | KKBRQYDSKUFLLG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |