C26H25N5O4S — CID 16859198
butyl 4-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate (PubChem CID 16859198) has the molecular formula C26H25N5O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is butyl 4-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16859198 |
| Molecular Formula | C26H25N5O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | butyl 4-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CC2CSc3nc4c(cnn4-c4ccccc4)c(=O)n32)cc1 |
| InChI | InChI=1S/C26H25N5O4S/c1-2-3-13-35-25(34)17-9-11-18(12-10-17)28-22(32)14-20-16-36-26-29-23-21(24(33)30(20)26)15-27-31(23)19-7-5-4-6-8-19/h4-12,15,20H,2-3,13-14,16H2,1H3,(H,28,32) |
| InChIKey | UGANPSRFTMCDFU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|