C29H26N6O2S — CID 16860615
N-(4-anilinophenyl)-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16860615) has the molecular formula C29H26N6O2S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(4-anilinophenyl)-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16860615 |
| Molecular Formula | C29H26N6O2S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-(4-anilinophenyl)-2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)Nc2ccc(Nc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C29H26N6O2S/c1-18-8-13-23(14-19(18)2)35-27-25(16-30-35)28(37)34-24(17-38-29(34)33-27)15-26(36)32-22-11-9-21(10-12-22)31-20-6-4-3-5-7-20/h3-14,16,24,31H,15,17H2,1-2H3,(H,32,36) |
| InChIKey | CLKMTCPURBEZPH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |