C22H17Cl2N5O2S — CID 16859425
N-(2,3-dichlorophenyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide (PubChem CID 16859425) has the molecular formula C22H17Cl2N5O2S and a molecular weight of 486.38 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
|---|---|
| PubChem CID | 16859425 |
| Molecular Formula | C22H17Cl2N5O2S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[6-(2-methylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetamide |
| SMILES | Cc1ccccc1-n1ncc2c(=O)n3c(nc21)SCC3CC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H17Cl2N5O2S/c1-12-5-2-3-8-17(12)29-20-14(10-25-29)21(31)28-13(11-32-22(28)27-20)9-18(30)26-16-7-4-6-15(23)19(16)24/h2-8,10,13H,9,11H2,1H3,(H,26,30) |
| InChIKey | FVVXZLDWVPSKTA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |