C26H33N5O2S — CID 16860466
2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3,3,5-trimethylcyclohexyl)acetamide (PubChem CID 16860466) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3,3,5-trimethylcyclohexyl)acetamide.
| Compound Name | 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3,3,5-trimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 16860466 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[6-(3,4-dimethylphenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(3,3,5-trimethylcyclohexyl)acetamide |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)NC2CC(C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/C26H33N5O2S/c1-15-8-18(12-26(4,5)11-15)28-22(32)10-20-14-34-25-29-23-21(24(33)30(20)25)13-27-31(23)19-7-6-16(2)17(3)9-19/h6-7,9,13,15,18,20H,8,10-12,14H2,1-5H3,(H,28,32) |
| InChIKey | VPEKGHKJUFYCGM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |