C22H15ClF3N5O2S — CID 16859855
2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 16859855) has the molecular formula C22H15ClF3N5O2S and a molecular weight of 505.91 g/mol. Its IUPAC name is 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16859855 |
| Molecular Formula | C22H15ClF3N5O2S |
| Molecular Weight | 505.91 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H15ClF3N5O2S/c23-13-2-1-3-15(8-13)31-19-17(10-27-31)20(33)30-16(11-34-21(30)29-19)9-18(32)28-14-6-4-12(5-7-14)22(24,25)26/h1-8,10,16H,9,11H2,(H,28,32) |
| InChIKey | BOWVAXNTJPXMNR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |