C27H28N6O2S — CID 16860664
6-(2,4-dimethylphenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16860664) has the molecular formula C27H28N6O2S and a molecular weight of 500.63 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(2,4-dimethylphenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16860664 |
| Molecular Formula | C27H28N6O2S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | Cc1ccc(-n2ncc3c(=O)n4c(nc32)SCC4CC(=O)N2CCCCC2c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C27H28N6O2S/c1-17-8-9-22(18(2)12-17)33-25-21(15-29-33)26(35)32-20(16-36-27(32)30-25)13-24(34)31-11-4-3-7-23(31)19-6-5-10-28-14-19/h5-6,8-10,12,14-15,20,23H,3-4,7,11,13,16H2,1-2H3 |
| InChIKey | LNRYJZFPSATQGJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |