C22H19ClN6O4S2 — CID 16859922
ethyl 2-[2-[[2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 16859922) has the molecular formula C22H19ClN6O4S2 and a molecular weight of 531.02 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16859922 |
| Molecular Formula | C22H19ClN6O4S2 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | ethyl 2-[2-[[2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CC2CSc3nc4c(cnn4-c4cccc(Cl)c4)c(=O)n32)n1 |
| InChI | InChI=1S/C22H19ClN6O4S2/c1-2-33-18(31)7-13-10-34-21(25-13)26-17(30)8-15-11-35-22-27-19-16(20(32)28(15)22)9-24-29(19)14-5-3-4-12(23)6-14/h3-6,9-10,15H,2,7-8,11H2,1H3,(H,25,26,30) |
| InChIKey | RULLVTMBBGWWRN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |